Name | (4'-Pentyl[1,1'-biphenyl]-4-yl)-boronic acid |
Synonyms | (4'-Pentyl-[1,1'-biphenyl]-4-yl) 4-(4-pentylphenyl)phenyl]boronicaci [4-(4-pentylphenyl)phenyl]boronic Acid (4'-Pentyl[1,1'-biphenyl]-4-yl)boronic acid (4'-Pentyl[1,1'-biphenyl]-4-yl)-boronic acid Boronic acid, (4'-pentyl[1,1'-biphenyl]-4-yl)- Boronic acid, B-(4'-pentyl[1,1'-biphenyl]-4-yl)- 4'-Pentyl-4-biphenylboronic Acid (contains varying amounts of Anhydride) |
CAS | 121554-18-5 |
InChI | InChI=1S/C17H21BO2/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(13-11-16)18(19)20/h6-13,19-20H,2-5H2,1H3 |
Molecular Formula | C17H21BO2 |
Molar Mass | 268.16 |
Density | 1.08±0.1 g/cm3(Predicted) |
Boling Point | 436.4±48.0 °C(Predicted) |
Flash Point | 217.754 °C |
Solubility | soluble in Methanol |
Appearance | powder to crystal |
Color | White to Almost white |
pKa | 8.61±0.17(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
Sensitive | IRRITANT |
MDL | MFCD07644474 |